CAS 1189106-62-4 appears in our catalog under these names: 7-Bromo-4-chloro-2,8-dimethylquinoline, 95%, 7-Bromo-4-chloro-2,8-dimethylquinoline 95+%, 7-Bromo-4-chloro-2,8-dimethylquinoline, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
7-bromo-4-chloro-2,8-dimethylquinoline (CAS 1189106-62-4) is a chemical compound with the molecular formula C11H9BrClN and a molecular weight of 270.55 g/mol. IUPAC name: 7-bromo-4-chloro-2,8-dimethylquinoline. InChIKey: JJOXAYSGWSYGNB-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClN |
|---|---|
| Molecular weight | 270.55 g/mol |
| IUPAC name | 7-bromo-4-chloro-2,8-dimethylquinoline |
| InChIKey | JJOXAYSGWSYGNB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC(=C(C2=N1)C)Br)Cl |
Computed by PubChem (NCBI)