cas: 159182-40-8 — see every product listed under this CAS number, including other names
Quinoline-3-sulfonyl chloride, 97% (CAS 159182-40-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241631-50MG |
| cas | 159182-40-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 539.41 Pln | |
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1018.41 Pln | |
| Fluorochem | 500mg | 1695.25 Pln | |
| Fluorochem | 1g | 2153.43 Pln | |
| Fluorochem | 2.5g | 3402.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Quinoline-3-sulfonyl chloride (CAS 159182-40-8) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: quinoline-3-sulfonyl chloride. InChIKey: VSAXLHSQUHPTCS-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | quinoline-3-sulfonyl chloride |
| InChIKey | VSAXLHSQUHPTCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)