cas: 102878-84-2 — see every product listed under this CAS number, including other names
Quinoline-5-sulfonyl chloride, 98% (CAS 102878-84-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219104-100MG |
| cas | 102878-84-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 794.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Quinoline-5-sulfonyl chloride (CAS 102878-84-2) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: quinoline-5-sulfonyl chloride. InChIKey: IGBMUOLGIDEIJH-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | quinoline-5-sulfonyl chloride |
| InChIKey | IGBMUOLGIDEIJH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=N2)C(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)