Quinoline-8-carboxylic acid, 98%
cas: 86-59-9 — see every product listed under this CAS number, including other names
Quinoline-8-carboxylic acid, 98% (CAS 86-59-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch114NJ1-250mg |
| cas | 86-59-9 |
| size | 250mg |
| availability | 300g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 342.80 Pln | |
| Chemat | 100g | 1202.00 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 292.14 Pln | |
| BLDpharm | 25g | 619.81 Pln | |
| BLDpharm | 100g | 2252.56 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Quinoline-8-carboxylic acid (CAS 86-59-9) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: quinoline-8-carboxylic acid. InChIKey: QRDZFPUVLYEQTA-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | quinoline-8-carboxylic acid |
| InChIKey | QRDZFPUVLYEQTA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)N=CC=C2 |
Computed by PubChem (NCBI)