CAS 20771-08-8 appears in our catalog under these names: 2-Phenyl-1,3-oxazole-4-carbaldehyde, 95%, 2-Phenyloxazole-4-carbaldehyde 97%, 2-phenyl-1,3-oxazole-4-carbaldehyde, 97%, 97%, 2-Phenyloxazole-4-carbaldehyde, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 50mg.
2-phenyl-1,3-oxazole-4-carbaldehyde (CAS 20771-08-8) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 2-phenyl-1,3-oxazole-4-carbaldehyde. InChIKey: SMJNJCYAIKTNKK-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 2-phenyl-1,3-oxazole-4-carbaldehyde |
| InChIKey | SMJNJCYAIKTNKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CO2)C=O |
Computed by PubChem (NCBI)