Products 16642-93-6
CAS 16642-93-6 appears in our catalog under these names: 3-Cyanocinnamic acid, 97%, 3–(3–Cyanophenyl)acrylic acid, 3-Cyanocinnamic acid, 3-(3-Cyanophenyl)acrylic acid 98% (E), trans-3-(3-Cyanophenyl)acrylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 50g, 250g, 100mg.
(E)-3-(3-cyanophenyl)prop-2-enoic acid (CAS 16642-93-6) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: (E)-3-(3-cyanophenyl)prop-2-enoic acid. InChIKey: WEYFZKRRQZYAJI-SNAWJCMRSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (E)-3-(3-cyanophenyl)prop-2-enoic acid |
| InChIKey | WEYFZKRRQZYAJI-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Cyanocinnamic acid, 3-(3-Cyanophenyl)acrylic acid, 2-Propenoic acid, 3-(3-cyanophenyl)-, (2E)-, (E)-3-(3-cyanophenyl)acrylic acid, (2E)-3-(3-cyanophenyl)prop-2-enoic acid, (E)-3-(3-cyanophenyl)prop-2-enoic acid, trans-3-(3-Cyanophenyl)acrylic acid, (2E)-3-(3-cyanophenyl)acrylic acid, 3-(3-cyanophenyl)prop-2-enoic acid, GNF-Pf-1514