Products 7159-36-6
CAS 7159-36-6 appears in our catalog under these names: Isoquinoline-4-carboxylic acid, 98%, Isoquinoline–4–carboxylic acid, Isoquinoline-4-carboxylic acid, 97% , Isoquinoline-4-carboxylic acid 98%, 4-Isoquinolinecarboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250MG, 100mg, 500mg, 50g.
Isoquinoline-4-carboxylic acid (CAS 7159-36-6) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: isoquinoline-4-carboxylic acid. InChIKey: MCVMLYSLPCECGO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | isoquinoline-4-carboxylic acid |
| InChIKey | MCVMLYSLPCECGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NC=C2C(=O)O |
Computed by PubChem (NCBI)