Products 61563-43-7
CAS 61563-43-7 appears in our catalog under these names: Isoquinoline-8-carboxylic acid, 98%, Isoquinoline–8–carboxylic acid, Isoquinoline-8-carboxylic acid, 97%, Isoquinoline-8-carboxylic acid 95%, Isoquinoline-8-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg, 50g, 100g.
Isoquinoline-8-carboxylic acid (CAS 61563-43-7) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: isoquinoline-8-carboxylic acid. InChIKey: VMNZQPRIUSJCOH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | isoquinoline-8-carboxylic acid |
| InChIKey | VMNZQPRIUSJCOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2)C(=C1)C(=O)O |
Computed by PubChem (NCBI)