CAS 2348-81-4 appears in our catalog under these names: 2-Aminonaphthalene-1,4-dione, 95%, 2-Aminonaphthalene-1,4-dione, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
2-aminonaphthalene-1,4-dione (CAS 2348-81-4) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 2-aminonaphthalene-1,4-dione. InChIKey: CYCRZLRIJWDWCM-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 2-aminonaphthalene-1,4-dione |
| InChIKey | CYCRZLRIJWDWCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(C2=O)N |
Computed by PubChem (NCBI)