cas: 844646-88-4 — see every product listed under this CAS number, including other names
Quinoxaline-5-sulfonyl chloride, 95% (CAS 844646-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238883-100MG |
| cas | 844646-88-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1601.54 Pln | |
| Fluorochem | 10g | 2689.70 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Quinoxaline-5-sulfonyl chloride (CAS 844646-88-4) is a chemical compound with the molecular formula C8H5ClN2O2S and a molecular weight of 228.66 g/mol. IUPAC name: quinoxaline-5-sulfonyl chloride. InChIKey: NAKORIYAIZIQHQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2S |
|---|---|
| Molecular weight | 228.66 g/mol |
| IUPAC name | quinoxaline-5-sulfonyl chloride |
| InChIKey | NAKORIYAIZIQHQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN=C2C(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)