Quinoxaline-5-sulfonyl chloride, 98%
cas: 844646-88-4 — see every product listed under this CAS number, including other names
Quinoxaline-5-sulfonyl chloride, 98% (CAS 844646-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A500147-100mg |
| cas | 844646-88-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 770.88 Pln | |
| Ambeed | 5g | 1644.19 Pln | |
| Ambeed | 10g | 2745.56 Pln | |
| BLDpharm | 100mg | 319.91 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 1763.85 Pln | |
| BLDpharm | 10g | 2957.87 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Quinoxaline-5-sulfonyl chloride (CAS 844646-88-4) is a chemical compound with the molecular formula C8H5ClN2O2S and a molecular weight of 228.66 g/mol. IUPAC name: quinoxaline-5-sulfonyl chloride. InChIKey: NAKORIYAIZIQHQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2S |
|---|---|
| Molecular weight | 228.66 g/mol |
| IUPAC name | quinoxaline-5-sulfonyl chloride |
| InChIKey | NAKORIYAIZIQHQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN=C2C(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)