Products 2642218-43-5
CAS 2642218-43-5 appears in our catalog under these names: RIG012, RIG012/ 99.53% (existing batch purity), RIG012 98% HPLC, 4-(Benzyloxy)-3,3-diethyl-2H-benzo[g]indole-2,5(3H)-dione, 98%, 98%, RIG012, 99.33%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 500mg.
3,3-diethyl-4-phenylmethoxybenzo[g]indole-2,5-dione (CAS 2642218-43-5) is a chemical compound with the molecular formula C23H21NO3 and a molecular weight of 359.4 g/mol. IUPAC name: 3,3-diethyl-4-phenylmethoxybenzo[g]indole-2,5-dione. InChIKey: OEWZCENSPLZNPQ-UHFFFAOYSA-N.
| Molecular formula | C23H21NO3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 3,3-diethyl-4-phenylmethoxybenzo[g]indole-2,5-dione |
| InChIKey | OEWZCENSPLZNPQ-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(C(=O)C3=CC=CC=C3C2=NC1=O)OCC4=CC=CC=C4)CC |
Computed by PubChem (NCBI)