Rasagiline mesylate, 98%
cas: 161735-79-1 — see every product listed under this CAS number, including other names
Rasagiline mesylate, 98% (CAS 161735-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250MG, 10g, 25g, 100g. Offered by: Thermo Scientific (Acros), Chemat, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 470200010 |
| cas | 161735-79-1 |
| size | 1g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 1037.89 Pln | |
| Thermo Scientific (Acros) | 5g | 3033.48 Pln | |
| Thermo Scientific (Acros) | 250MG | 345.67 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 10g | 578.00 Pln | |
| Chemat | 25g | 1163.60 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 903.87 Pln | |
| Fluorochem | 25g | 2944.81 Pln | |
| Fluorochem | 100g | 9213.44 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (CAS 161735-79-1) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. IUPAC name: methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine. InChIKey: JDBJJCWRXSVHOQ-UTONKHPSSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 267.35 g/mol |
| IUPAC name | methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | JDBJJCWRXSVHOQ-UTONKHPSSA-N |
| SMILES | CS(=O)(=O)O.C#CCN[C@@H]1CCC2=CC=CC=C12 |
Computed by PubChem (NCBI)
Synonyms:
Rasagiline mesylate, Azilect, Rasagiline mesilate, Agilect, Rasagiline methanesulfonate, Rasagline ratiopharm, Rasagiline (as mesilate), 1H-Inden-1-amine, 2,3-dihydro-N-2-propynyl-, (R)-, methanesulfonate, (R)-N-(Prop-2-yn-1-yl)-2,3-dihydro-1H-inden-1-amine methanesulfonate, Rasagiline mesylate [USAN]