Products 1216757-55-9
CAS 1216757-55-9 appears in our catalog under these names: rac Rasagiline-13C3 Mesylate, >95% (HPLC), Rasagiline-13C3 (mesylate racemic). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
Methanesulfonic acid;N-(1,2,3-13C3)prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (CAS 1216757-55-9) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 270.32 g/mol. IUPAC name: methanesulfonic acid;N-(1,2,3-13C3)prop-2-ynyl-2,3-dihydro-1H-inden-1-amine. InChIKey: JDBJJCWRXSVHOQ-IZHPGBHVSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | methanesulfonic acid;N-(1,2,3-13C3)prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | JDBJJCWRXSVHOQ-IZHPGBHVSA-N |
| SMILES | CS(=O)(=O)O.[13CH]#[13C][13CH2]NC1CCC2=CC=CC=C12 |
Computed by PubChem (NCBI)