Products 1391068-00-0
CAS 1391068-00-0 is the registry number for (S)-Rasagiline-13C3 Mesylate. Offered by: TRC. Available pack sizes: 500mg.
Methanesulfonic acid;(1S)-N-(1,2,3-13C3)prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (CAS 1391068-00-0) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 270.32 g/mol. IUPAC name: methanesulfonic acid;(1S)-N-(1,2,3-13C3)prop-2-ynyl-2,3-dihydro-1H-inden-1-amine. InChIKey: JDBJJCWRXSVHOQ-AJPOOADWSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | methanesulfonic acid;(1S)-N-(1,2,3-13C3)prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | JDBJJCWRXSVHOQ-AJPOOADWSA-N |
| SMILES | CS(=O)(=O)O.[13CH]#[13C][13CH2]N[C@H]1CCC2=CC=CC=C12 |
Computed by PubChem (NCBI)