cas: 4775-80-8 — see every product listed under this CAS number, including other names
S–Phenylmercapturic Acid (CAS 4775-80-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC41628-10 |
| cas | 4775-80-8 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 648.53 Pln | |
| GLPBio | 100mg | 1256.99 Pln | |
| GLPBio | 25mg | 793.62 Pln | |
| GLPBio | 5mg | 564.28 Pln | |
| GLPBio | 50mg | 985.52 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-acetamido-3-phenylsulfanylpropanoic acid (CAS 4775-80-8) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: (2R)-2-acetamido-3-phenylsulfanylpropanoic acid. InChIKey: CICOZWHZVMOPJS-JTQLQIEISA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | (2R)-2-acetamido-3-phenylsulfanylpropanoic acid |
| InChIKey | CICOZWHZVMOPJS-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CSC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)