cas: 4775-80-8 — see every product listed under this CAS number, including other names
S-Phenylmercapturic acid (CAS 4775-80-8) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10000mg, 25000mg. Offered by: TargetMol, Biosynth.
| brand | TargetMol |
|---|---|
| catalog number | T73940-5mg |
| cas | 4775-80-8 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 691.36 Pln | |
| TargetMol | 10mg | 1163.16 Pln | |
| TargetMol | 25mg | 1667.38 Pln | |
| TargetMol | 50mg | 2046.38 Pln | |
| Biosynth | 100mg | price on request | |
| Biosynth | 250mg | price on request | |
| Biosynth | 10000mg | price on request | |
| Biosynth | 25000mg | price on request |
| purity | No data |
|---|---|
| delivery time | on request |
(2R)-2-acetamido-3-phenylsulfanylpropanoic acid (CAS 4775-80-8) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: (2R)-2-acetamido-3-phenylsulfanylpropanoic acid. InChIKey: CICOZWHZVMOPJS-JTQLQIEISA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | (2R)-2-acetamido-3-phenylsulfanylpropanoic acid |
| InChIKey | CICOZWHZVMOPJS-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CSC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)