CAS 247580-43-4 appears in our catalog under these names: SB 328437/ 99.11% (existing batch purity), SB 328437, SB 328437, SB 328437, 98%, 98%, SB-328437, 99.58%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 50 mg.
Methyl (2S)-2-(naphthalene-1-carbonylamino)-3-(4-nitrophenyl)propanoate (CAS 247580-43-4) is a chemical compound with the molecular formula C21H18N2O5 and a molecular weight of 378.4 g/mol. IUPAC name: methyl (2S)-2-(naphthalene-1-carbonylamino)-3-(4-nitrophenyl)propanoate. InChIKey: VMFGCGRAIBLAFY-IBGZPJMESA-N.
| Molecular formula | C21H18N2O5 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | methyl (2S)-2-(naphthalene-1-carbonylamino)-3-(4-nitrophenyl)propanoate |
| InChIKey | VMFGCGRAIBLAFY-IBGZPJMESA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)