Products 1259484-97-3
CAS 1259484-97-3 appears in our catalog under these names: SKI 178, SKI-178/ 99.2% (existing batch purity), SKI 178, SKI-178, ≥98%, ≥98%, SKI-178, 99.29%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 200mg, 500mg, 1mg.
N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide (CAS 1259484-97-3) is a chemical compound with the molecular formula C21H22N4O4 and a molecular weight of 394.4 g/mol. IUPAC name: N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide. InChIKey: GMFUWEBOUKIKRP-LPYMAVHISA-N.
| Molecular formula | C21H22N4O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| InChIKey | GMFUWEBOUKIKRP-LPYMAVHISA-N |
| SMILES | C/C(=N\NC(=O)C1=CC(=NN1)C2=CC=C(C=C2)OC)/C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)