CAS 163126-81-6 appears in our catalog under these names: Sepin-1/ 96.05% (existing batch purity), Sepin–1, 2,2-Dimethyl-5-nitro-2H-benzimidazole-1,3-dioxide, Sepin-1, Sepin-1, 99.29%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 5 mg.
2,2-dimethyl-5-nitro-3-oxidobenzimidazol-1-ium 1-oxide (CAS 163126-81-6) is a chemical compound with the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. IUPAC name: 2,2-dimethyl-5-nitro-3-oxidobenzimidazol-1-ium 1-oxide. InChIKey: YLVSVJDCTDBERH-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O4 |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 2,2-dimethyl-5-nitro-3-oxidobenzimidazol-1-ium 1-oxide |
| InChIKey | YLVSVJDCTDBERH-UHFFFAOYSA-N |
| SMILES | CC1(N(C2=C([N+]1=O)C=CC(=C2)[N+](=O)[O-])[O-])C |
Computed by PubChem (NCBI)