cas: 18422-53-2 — see every product listed under this CAS number, including other names
Shi Epoxidation Diketal Catalyst, 99% (CAS 18422-53-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F097592-100MG |
| cas | 18422-53-2 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 2.5g | 185.37 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 383.22 Pln | |
| Fluorochem | 25g | 747.67 Pln | |
| Fluorochem | 100g | 2788.62 Pln |
| purity | 99% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(3'aR,4S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-one (CAS 18422-53-2) is a chemical compound with the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. IUPAC name: (3'aR,4S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-one. InChIKey: IVWWFWFVSWOTLP-RWYTXXIDSA-N.
| Molecular formula | C12H18O6 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (3'aR,4S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-one |
| InChIKey | IVWWFWFVSWOTLP-RWYTXXIDSA-N |
| SMILES | CC1(OC[C@]2(O1)C(=O)[C@H]3[C@@H](CO2)OC(O3)(C)C)C |
Computed by PubChem (NCBI)