Products 1318075-13-6
CAS 1318075-13-6 appears in our catalog under these names: Simtuzumab/ SDS-Page: 95%, SEC-HPLC: 95%, Simtuzumab, Simtuzumab, 99.0%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
4-borono-3-chlorobenzoic acid (CAS 1318075-13-6) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: 4-borono-3-chlorobenzoic acid. InChIKey: FYDHSNLXZRGWFU-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | 4-borono-3-chlorobenzoic acid |
| InChIKey | FYDHSNLXZRGWFU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)O)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-borono-3-chlorobenzoic acid, 3-chloro-4-(dihydroxyboranyl)benzoic acid, simtuzumabum, SIMTUZUMAB [INN], Simtuzumab [USAN:INN], SIMTUZUMAB [USAN], SIMTUZUMAB [WHO-DD], Recombinant humanized anti-LOXL2 monoclonal antibody, 2-Chloro-4-carboxyphenylboronic acid, 4-Carboxy-2-chlorobenzeneboronic acid