CAS 444932-31-4 appears in our catalog under these names: TC-O 9311/ 99.12% (existing batch purity), TC–O 9311, TC-O 9311, 2-(3,5-Dimethoxybenzoyl)-N-(naphthalen-1-yl)hydrazinecarboxamide, 98%, 98%, TC-O 9311, 99.83%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 10 mg.
1-[(3,5-dimethoxybenzoyl)amino]-3-naphthalen-1-ylurea (CAS 444932-31-4) is a chemical compound with the molecular formula C20H19N3O4 and a molecular weight of 365.4 g/mol. IUPAC name: 1-[(3,5-dimethoxybenzoyl)amino]-3-naphthalen-1-ylurea. InChIKey: KPTMSQHTGZMEFU-UHFFFAOYSA-N.
| Molecular formula | C20H19N3O4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 1-[(3,5-dimethoxybenzoyl)amino]-3-naphthalen-1-ylurea |
| InChIKey | KPTMSQHTGZMEFU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)NNC(=O)NC2=CC=CC3=CC=CC=C32)OC |
Computed by PubChem (NCBI)