Products 1082739-92-1
CAS 1082739-92-1 appears in our catalog under these names: TC-S 7005/ 99.44% (existing batch purity), TC–S 7005, TC-S 7005, TC-S 7005 98%, 3-(1,3-Benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]isoxazolo[5,4-c]pyridin-5-amine, ≥98%(HPLC), ≥98%(HPLC). Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg.
3-(1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]-[1,2]oxazolo[5,4-c]pyridin-5-amine (CAS 1082739-92-1) is a chemical compound with the molecular formula C21H17N3O3 and a molecular weight of 359.4 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]-[1,2]oxazolo[5,4-c]pyridin-5-amine. InChIKey: DAAGOCSHXCDWDY-ZDUSSCGKSA-N.
| Molecular formula | C21H17N3O3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-N-[(1S)-1-phenylethyl]-[1,2]oxazolo[5,4-c]pyridin-5-amine |
| InChIKey | DAAGOCSHXCDWDY-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC2=NC=C3C(=C2)C(=NO3)C4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)