CAS 259870-32-1 appears in our catalog under these names: TGFβ–IN–5, TGFβ-IN-5/ 99.5% (existing batch purity), TGFβ-IN-5, ≥98%, ≥98%, TGFβ-IN-5, 98.03%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
2-phenyl-N-(pyridin-4-ylmethyl)quinazolin-4-amine (CAS 259870-32-1) is a chemical compound with the molecular formula C20H16N4 and a molecular weight of 312.4 g/mol. IUPAC name: 2-phenyl-N-(pyridin-4-ylmethyl)quinazolin-4-amine. InChIKey: PJZIQCMPDKJSKB-UHFFFAOYSA-N.
| Molecular formula | C20H16N4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 2-phenyl-N-(pyridin-4-ylmethyl)quinazolin-4-amine |
| InChIKey | PJZIQCMPDKJSKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=N2)NCC4=CC=NC=C4 |
Computed by PubChem (NCBI)