cas: 1268163-15-0 — see every product listed under this CAS number, including other names
TL8-506 (CAS 1268163-15-0) is a chemical reagent available from Chemat. Available pack sizes: 25MG, 5MG, 2mg, 10mg, 50mg, 100mg, 200mg. Offered by: Sigma-Aldrich, Chemat.
| brand | Sigma-Aldrich |
|---|---|
| catalog number | SML3687-25MG |
| cas | 1268163-15-0 |
| size | 25MG |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Sigma-Aldrich | 25MG | 4110.00 Pln | |
| Sigma-Aldrich | 5MG | 1060.00 Pln | |
| Chemat | 2mg | 1312.40 Pln | |
| Chemat | 5mg | 2037.20 Pln | |
| Chemat | 10mg | 3477.20 Pln | |
| Chemat | 25mg | 5267.60 Pln | |
| Chemat | 50mg | 6856.40 Pln | |
| Chemat | 100mg | 9496.40 Pln | |
| Chemat | 200mg | 12803.60 Pln |
Ethyl 2-amino-8-(3-cyanophenyl)-3H-1-benzazepine-4-carboxylate (CAS 1268163-15-0) is a chemical compound with the molecular formula C20H17N3O2 and a molecular weight of 331.4 g/mol. IUPAC name: ethyl 2-amino-8-(3-cyanophenyl)-3H-1-benzazepine-4-carboxylate. InChIKey: YHRYTTWRVKXODS-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O2 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | ethyl 2-amino-8-(3-cyanophenyl)-3H-1-benzazepine-4-carboxylate |
| InChIKey | YHRYTTWRVKXODS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C(C=C2)C3=CC=CC(=C3)C#N)N=C(C1)N |
Computed by PubChem (NCBI)