CAS 94678-45-2 is the registry number for 1,3,5-Tri(3-pyridyl)-1,5-pentanoate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
1,3,5-tripyridin-3-ylpentane-1,5-dione (CAS 94678-45-2) is a chemical compound with the molecular formula C20H17N3O2 and a molecular weight of 331.4 g/mol. IUPAC name: 1,3,5-tripyridin-3-ylpentane-1,5-dione. InChIKey: QJZCWKXSMMCGNW-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O2 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 1,3,5-tripyridin-3-ylpentane-1,5-dione |
| InChIKey | QJZCWKXSMMCGNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(CC(=O)C2=CN=CC=C2)CC(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)