CAS 1268163-15-0 appears in our catalog under these names: TL8-506, 98%, TL8–506, TL8-506, TL8-506 (GMP), TL8-506, 95.0%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 200mg, Get quote, 50 mg.
Ethyl 2-amino-8-(3-cyanophenyl)-3H-1-benzazepine-4-carboxylate (CAS 1268163-15-0) is a chemical compound with the molecular formula C20H17N3O2 and a molecular weight of 331.4 g/mol. IUPAC name: ethyl 2-amino-8-(3-cyanophenyl)-3H-1-benzazepine-4-carboxylate. InChIKey: YHRYTTWRVKXODS-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O2 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | ethyl 2-amino-8-(3-cyanophenyl)-3H-1-benzazepine-4-carboxylate |
| InChIKey | YHRYTTWRVKXODS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C(C=C2)C3=CC=CC(=C3)C#N)N=C(C1)N |
Computed by PubChem (NCBI)