CAS 261722-41-2 is the registry number for 1,3-Dibenzyl-1,6-dihydro-2H-pyrrolo[3,4-d]pyrimidine-2,4(3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dibenzyl-6H-pyrrolo[3,4-d]pyrimidine-2,4-dione (CAS 261722-41-2) is a chemical compound with the molecular formula C20H17N3O2 and a molecular weight of 331.4 g/mol. IUPAC name: 1,3-dibenzyl-6H-pyrrolo[3,4-d]pyrimidine-2,4-dione. InChIKey: NJJNOKTYVMADBZ-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O2 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 1,3-dibenzyl-6H-pyrrolo[3,4-d]pyrimidine-2,4-dione |
| InChIKey | NJJNOKTYVMADBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CNC=C3C(=O)N(C2=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)