Products 107634-85-5
CAS 107634-85-5 is the registry number for 2-indol-3-yl-N-(2-indol-3-ylethyl)-2-oxoethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(1H-indol-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide (CAS 107634-85-5) is a chemical compound with the molecular formula C20H17N3O2 and a molecular weight of 331.4 g/mol. IUPAC name: 2-(1H-indol-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide. InChIKey: KBMAPSVVTDUGNY-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O2 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-N-[2-(1H-indol-3-yl)ethyl]-2-oxoacetamide |
| InChIKey | KBMAPSVVTDUGNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)C(=O)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)