CAS 1609577-07-2 is the registry number for 4-(4-(4,6-Dimethylpyrimidin-5-yl)-3-methylphenoxy)furo(3,2-c)pyridine, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
4-[4-(4,6-dimethylpyrimidin-5-yl)-3-methylphenoxy]furo[3,2-c]pyridine (CAS 1609577-07-2) is a chemical compound with the molecular formula C20H17N3O2 and a molecular weight of 331.4 g/mol. IUPAC name: 4-[4-(4,6-dimethylpyrimidin-5-yl)-3-methylphenoxy]furo[3,2-c]pyridine. InChIKey: ZHKNZPAEDFNJIG-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O2 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 4-[4-(4,6-dimethylpyrimidin-5-yl)-3-methylphenoxy]furo[3,2-c]pyridine |
| InChIKey | ZHKNZPAEDFNJIG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=NC=CC3=C2C=CO3)C4=C(N=CN=C4C)C |
Computed by PubChem (NCBI)