cas: 17557-67-4 — see every product listed under this CAS number, including other names
TbPTR1 inhibitor 2, 99.73% (CAS 17557-67-4) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 10 g, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W009689-10mM/1mL |
| cas | 17557-67-4 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 10 g | 454.37 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 5 g | 361.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.73% |
6-methylsulfonyl-1,3-benzothiazol-2-amine (CAS 17557-67-4) is a chemical compound with the molecular formula C8H8N2O2S2 and a molecular weight of 228.3 g/mol. IUPAC name: 6-methylsulfonyl-1,3-benzothiazol-2-amine. InChIKey: ZYHNHJAMVNINSY-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S2 |
|---|---|
| Molecular weight | 228.3 g/mol |
| IUPAC name | 6-methylsulfonyl-1,3-benzothiazol-2-amine |
| InChIKey | ZYHNHJAMVNINSY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)N=C(S2)N |
Computed by PubChem (NCBI)