CAS 17557-67-4 appears in our catalog under these names: 2-Amino-6-(methylsulfonyl)benzothiazole, 98%, Pramipexole Impurity 33, 6-(Methylsulfonyl)-1,3-benzothiazol-2-amine, 98%, TbPTR1 inhibitor 2/ 97.2% (existing batch purity), TbPTR1 inhibitor 2. Offered by: Combi-blocks, Chemat Brand, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 25g, 5g, 1g, 100g, on request, 10mg, 25mg, 50mg.
6-methylsulfonyl-1,3-benzothiazol-2-amine (CAS 17557-67-4) is a chemical compound with the molecular formula C8H8N2O2S2 and a molecular weight of 228.3 g/mol. IUPAC name: 6-methylsulfonyl-1,3-benzothiazol-2-amine. InChIKey: ZYHNHJAMVNINSY-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S2 |
|---|---|
| Molecular weight | 228.3 g/mol |
| IUPAC name | 6-methylsulfonyl-1,3-benzothiazol-2-amine |
| InChIKey | ZYHNHJAMVNINSY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)N=C(S2)N |
Computed by PubChem (NCBI)