cas: 951884-50-7 — see every product listed under this CAS number, including other names
Tert-Butyl 2-bromo-4-fluorobenzoate, 98% (CAS 951884-50-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632396-5G |
| cas | 951884-50-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 502.97 Pln | |
| Fluorochem | 25g | 2262.76 Pln | |
| Fluorochem | 100g | 7099.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-bromo-4-fluorobenzoate (CAS 951884-50-7) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 2-bromo-4-fluorobenzoate. InChIKey: NCGLBILYMNWPMU-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 2-bromo-4-fluorobenzoate |
| InChIKey | NCGLBILYMNWPMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)