CAS 889858-08-6 appears in our catalog under these names: tert-Butyl 5-bromo-2-fluorobenzoate, 95%, tert-Butyl 5-bromo-2-fluorobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
Tert-butyl 5-bromo-2-fluorobenzoate (CAS 889858-08-6) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 5-bromo-2-fluorobenzoate. InChIKey: RGUSYURXTLDCDB-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 5-bromo-2-fluorobenzoate |
| InChIKey | RGUSYURXTLDCDB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)