CAS 951884-50-7 appears in our catalog under these names: tert-Butyl 2-bromo-4-fluorobenzoate, 96%, Tert-Butyl 2-bromo-4-fluorobenzoate, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g.
Tert-butyl 2-bromo-4-fluorobenzoate (CAS 951884-50-7) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 2-bromo-4-fluorobenzoate. InChIKey: NCGLBILYMNWPMU-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 2-bromo-4-fluorobenzoate |
| InChIKey | NCGLBILYMNWPMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)