CAS 375368-94-8 appears in our catalog under these names: t-Butyl 3-bromo-4-fluorobenzoate, 98%, tert–Butyl 3–bromo–4–fluorobenzoate, tert-Butyl 3-bromo-4-fluorobenzoate 97%, tert-Butyl 3-bromo-4-fluorobenzoate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg.
Tert-butyl 3-bromo-4-fluorobenzoate (CAS 375368-94-8) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 3-bromo-4-fluorobenzoate. InChIKey: MUGCZCJMBJFCIX-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 3-bromo-4-fluorobenzoate |
| InChIKey | MUGCZCJMBJFCIX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)F)Br |
Computed by PubChem (NCBI)