Products 1263281-14-6
CAS 1263281-14-6 appears in our catalog under these names: tert-Butyl 2-bromo-5-fluorobenzoate, 96%, tert–Butyl 2–bromo–5–fluorobenzoate, tert-Butyl 2-bromo-5-fluorobenzoate, tert-Butyl 2-bromo-5-fluorobenzoate 95%, Tert-butyl 2-bromo-5-fluorobenzoate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 2,5g, 100mg.
Tert-butyl 2-bromo-5-fluorobenzoate (CAS 1263281-14-6) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 2-bromo-5-fluorobenzoate. InChIKey: YTPNUWRXGPLOBX-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 2-bromo-5-fluorobenzoate |
| InChIKey | YTPNUWRXGPLOBX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)F)Br |
Computed by PubChem (NCBI)