Products 1958100-37-2
CAS 1958100-37-2 appears in our catalog under these names: tert-Butyl 4-bromo-2-fluorobenzoate-1,2,3,4,5,6-13c6, 95%, TERT-BUTYL 4-BROMO-2-FLUOROBENZOATE-1,2,3,4,5,6-13C6, 98% 98%atom%13C. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g.
Tert-butyl 4-bromo-2-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate (CAS 1958100-37-2) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 281.07 g/mol. IUPAC name: tert-butyl 4-bromo-2-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate. InChIKey: ZPGZHSAOCVWZMR-VFESMUGCSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 281.07 g/mol |
| IUPAC name | tert-butyl 4-bromo-2-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
| InChIKey | ZPGZHSAOCVWZMR-VFESMUGCSA-N |
| SMILES | CC(C)(C)OC(=O)[13C]1=[13C]([13CH]=[13C]([13CH]=[13CH]1)Br)F |
Computed by PubChem (NCBI)