cas: 120157-95-1 — see every product listed under this CAS number, including other names
Tert-butyl (4-chlorobenzyl)carbamate, 97%, 97% (CAS 120157-95-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HF05-100mg |
| cas | 120157-95-1 |
| size | 100mg |
| availability | 615g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1398.80 Pln | |
| Chemat | 5g | 5171.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(4-chlorophenyl)methyl]carbamate (CAS 120157-95-1) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: tert-butyl N-[(4-chlorophenyl)methyl]carbamate. InChIKey: DWKFLKALAMAVJY-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | tert-butyl N-[(4-chlorophenyl)methyl]carbamate |
| InChIKey | DWKFLKALAMAVJY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)