cas: 120157-95-1 — see every product listed under this CAS number, including other names
tert-Butyl (4-chlorobenzyl)carbamate 98% (CAS 120157-95-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A837359-100mg |
| cas | 120157-95-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 882.12 Pln | |
| Ambeed | 1g | 1694.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A837359 |
Tert-butyl N-[(4-chlorophenyl)methyl]carbamate (CAS 120157-95-1) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: tert-butyl N-[(4-chlorophenyl)methyl]carbamate. InChIKey: DWKFLKALAMAVJY-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | tert-butyl N-[(4-chlorophenyl)methyl]carbamate |
| InChIKey | DWKFLKALAMAVJY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)