Products 2416132-74-4
CAS 2416132-74-4 appears in our catalog under these names: Thalidomide 5-pyrrolidine-CHO, Thalidomide 5-pyrrolidine-CHO, 95%. Offered by: MedChemExpress, Fluorochem, Ambeed. Available pack sizes: Get quote, 100mg, 25mg, 50mg, 250mg, 1g.
(3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carbaldehyde (CAS 2416132-74-4) is a chemical compound with the molecular formula C18H17N3O5 and a molecular weight of 355.3 g/mol. IUPAC name: (3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carbaldehyde. InChIKey: RYKJAWUKWUTSNW-IAPIXIRKSA-N.
| Molecular formula | C18H17N3O5 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | (3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carbaldehyde |
| InChIKey | RYKJAWUKWUTSNW-IAPIXIRKSA-N |
| SMILES | C1CN(C[C@@H]1C=O)C2=CC3=C(C=C2)C(=O)N(C3=O)C4CCC(=O)NC4=O |
Computed by PubChem (NCBI)