Products 2416133-57-6
CAS 2416133-57-6 is the registry number for Thalidomide-Pip-4-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,6-dioxopiperidin-3-yl)-5-(4-oxopiperidin-1-yl)isoindole-1,3-dione (CAS 2416133-57-6) is a chemical compound with the molecular formula C18H17N3O5 and a molecular weight of 355.3 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-5-(4-oxopiperidin-1-yl)isoindole-1,3-dione. InChIKey: AZQKHMNYDWNNDP-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O5 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-5-(4-oxopiperidin-1-yl)isoindole-1,3-dione |
| InChIKey | AZQKHMNYDWNNDP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)N4CCC(=O)CC4 |
Computed by PubChem (NCBI)