Products 2126176-74-5

CAS 2126176-74-5 is the registry number for 2-Phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethan-1-amine, oxalic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Oxalic acid;2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine (CAS 2126176-74-5) is a chemical compound with the molecular formula C18H17N3O5 and a molecular weight of 355.3 g/mol. IUPAC name: oxalic acid;2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine. InChIKey: YQLKEIAJBKBFHR-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17N3O5
Molecular weight355.3 g/mol
IUPAC nameoxalic acid;2-phenyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine
InChIKeyYQLKEIAJBKBFHR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(C2=NC(=NO2)C3=CC=CC=C3)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)