Products 315673-24-6

CAS 315673-24-6 is the registry number for 2-(2-(4-Oxo-4-(phenylamino)butanoyl)hydrazine-1-carbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[(4-anilino-4-oxobutanoyl)amino]carbamoyl]benzoic acid (CAS 315673-24-6) is a chemical compound with the molecular formula C18H17N3O5 and a molecular weight of 355.3 g/mol. IUPAC name: 2-[[(4-anilino-4-oxobutanoyl)amino]carbamoyl]benzoic acid. InChIKey: CUDNPXDTAMOWEV-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17N3O5
Molecular weight355.3 g/mol
IUPAC name2-[[(4-anilino-4-oxobutanoyl)amino]carbamoyl]benzoic acid
InChIKeyCUDNPXDTAMOWEV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC(=O)CCC(=O)NNC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)