CAS 69408-75-9 appears in our catalog under these names: LysoFP–NO2, 2-(2-Morpholin-4-ylethyl)-5-nitrobenzo(de)isoquinoline-1,3-dione, LysoFP-NO2, 98.2%, LysoFP-NO2, 98%. Offered by: GLPBio, Biosynth, MedChemExpress, Ambeed. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 1 mg, 5 mg.
2-(2-morpholin-4-ylethyl)-5-nitrobenzo[de]isoquinoline-1,3-dione (CAS 69408-75-9) is a chemical compound with the molecular formula C18H17N3O5 and a molecular weight of 355.3 g/mol. IUPAC name: 2-(2-morpholin-4-ylethyl)-5-nitrobenzo[de]isoquinoline-1,3-dione. InChIKey: MQBIIGAYEJQXCC-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O5 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | 2-(2-morpholin-4-ylethyl)-5-nitrobenzo[de]isoquinoline-1,3-dione |
| InChIKey | MQBIIGAYEJQXCC-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCN2C(=O)C3=CC=CC4=CC(=CC(=C43)C2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)