CAS 1076198-34-9 is the registry number for Isradipine lactone. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate (CAS 1076198-34-9) is a chemical compound with the molecular formula C18H17N3O5 and a molecular weight of 355.3 g/mol. IUPAC name: propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate. InChIKey: MDPKWTOXKXUQSW-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O5 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate |
| InChIKey | MDPKWTOXKXUQSW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C2=C(N1)COC2=O)C3=CC=CC4=NON=C43)C(=O)OC(C)C |
Computed by PubChem (NCBI)