Products 1212327-46-2
CAS 1212327-46-2 appears in our catalog under these names: Trans (+/-) 4-(2-chlorophenyl)pyrrolidine-3-methylcarboxylate hydrochloride, 95%, trans-Methyl 4-(2-chlorophenyl)pyrrolidine-3-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Methyl (3S)-4-(2-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 1212327-46-2) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: methyl (3S)-4-(2-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: GPSAQXGZGMSPEQ-FJYJDOHQSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | methyl (3S)-4-(2-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | GPSAQXGZGMSPEQ-FJYJDOHQSA-N |
| SMILES | COC(=O)[C@@H]1CNCC1C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)