cas: 90657-55-9 — see every product listed under this CAS number, including other names
Trans-4-cyclohexyl-l-proline, HCl, 97%, 97% (CAS 90657-55-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IG01-250mg |
| cas | 90657-55-9 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 736.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,4S)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 90657-55-9) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: (2S,4S)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: BHGFUQJUTOVQOS-UXQCFNEQSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | (2S,4S)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | BHGFUQJUTOVQOS-UXQCFNEQSA-N |
| SMILES | C1CCC(CC1)[C@@H]2C[C@H](NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)