CAS 82087-68-1 appears in our catalog under these names: cis-4-Cyclohexylpyrrolidine-2-carboxylic acid hydrochloride, 98%, cis-4-Cyclohexylpyrrolidine-2-carboxylic acid hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(2S,4R)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 82087-68-1) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: (2S,4R)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: BHGFUQJUTOVQOS-IYPAPVHQSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | (2S,4R)-4-cyclohexylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | BHGFUQJUTOVQOS-IYPAPVHQSA-N |
| SMILES | C1CCC(CC1)[C@H]2C[C@H](NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)